About tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate
tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate (PubChem CID 161316459) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate |
| PubChem CID | 161316459 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(-c2ccnc3c2-c2ccccc2C3)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-23(2,3)27-22(26)25-17-9-6-8-15(13-17)19-11-12-24-20-14-16-7-4-5-10-18(16)21(19)20/h4-13H,14H2,1-3H3,(H,25,26) |
| InChIKey | SMARMYKFKZTQTI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate?
The IUPAC name of tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate (CID 161316459) is tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate.
What is the SMILES notation for tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate?
The canonical SMILES for tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate is CC(C)(C)OC(=O)Nc1cccc(-c2ccnc3c2-c2ccccc2C3)c1.
What is the InChIKey of tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate?
The InChIKey is SMARMYKFKZTQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O2/c1-23(2,3)27-22(26)25-17-9-6-8-15(13-17)19-11-12-24-20-14-16-7-4-5-10-18(16)21(19)20/h4-13H,14H2,1-3H3,(H,25,26).
What are the key properties of tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate?
tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate has a molecular weight of 358.44 g/mol, XLogP of 5.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-(9H-indeno[2,1-b]pyridin-4-yl)phenyl]carbamate is sourced from PubChem (CID 161316459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).