C24H29ClF3N2O3S+ — CID 161319302
N-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxobutyl]benzenesulfonamide (PubChem CID 161319302) has the molecular formula C24H29ClF3N2O3S+ and a molecular weight of 518.02 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxobutyl]benzenesulfonamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxobutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 161319302 |
| Molecular Formula | C24H29ClF3N2O3S+ |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxobutyl]benzenesulfonamide |
| SMILES | C[N+]1(C)CCC(CCC(=O)CN(c2cc(C(F)(F)F)ccc2Cl)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29ClF3N2O3S/c1-30(2)14-12-18(13-15-30)8-10-20(31)17-29(34(32,33)21-6-4-3-5-7-21)23-16-19(24(26,27)28)9-11-22(23)25/h3-7,9,11,16,18H,8,10,12-15,17H2,1-2H3/q+1 |
| InChIKey | VJXRAJRMWHXBQC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|