C35H35Cl2N7O6S2 — CID 161321963
6-chloropyridazine-3-sulfonamide;N-(6-chloropyridazin-3-yl)sulfonyl-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide;1,2,3,5,6,7-hexahydro-s-indacen-4-yl cyanate (PubChem CID 161321963) has the molecular formula C35H35Cl2N7O6S2 and a molecular weight of 784.75 g/mol. Its IUPAC name is 6-chloropyridazine-3-sulfonamide;N-(6-chloropyridazin-3-yl)sulfonyl-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide;1,2,3,5,6,7-hexahydro-s-indacen-4-yl cyanate.
| Compound Name | 6-chloropyridazine-3-sulfonamide;N-(6-chloropyridazin-3-yl)sulfonyl-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide;1,2,3,5,6,7-hexahydro-s-indacen-4-yl cyanate |
|---|---|
| PubChem CID | 161321963 |
| Molecular Formula | C35H35Cl2N7O6S2 |
| Molecular Weight | 784.75 g/mol |
| Exact Mass | 783.15 |
| IUPAC Name | 6-chloropyridazine-3-sulfonamide;N-(6-chloropyridazin-3-yl)sulfonyl-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide;1,2,3,5,6,7-hexahydro-s-indacen-4-yl cyanate |
| SMILES | N#COc1c2c(cc3c1CCC3)CCC2.NS(=O)(=O)c1ccc(Cl)nn1.O=C(Cc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C18H18ClN3O3S.C13H13NO.C4H4ClN3O2S/c19-16-7-8-18(21-20-16)26(24,25)22-17(23)10-15-13-5-1-3-11(13)9-12-4-2-6-14(12)15;14-8-15-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;5-3-1-2-4(8-7-3)11(6,9)10/h7-9H,1-6,10H2,(H,22,23);7H,1-6H2;1-2H,(H2,6,9,10) |
| InChIKey | VKGLWIQMZBDNDV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 207.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|