C20H27N5NaO3S — CID 155390020
CID 155390020 (PubChem CID 155390020) has the molecular formula C20H27N5NaO3S and a molecular weight of 440.53 g/mol.
| Compound Name | CID 155390020 |
|---|---|
| PubChem CID | 155390020 |
| Molecular Formula | C20H27N5NaO3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | — |
| SMILES | Cn1cc(N(CCN)S(=O)(=O)NC(=O)Cc2c3c(cc4c2CCC4)CCC3)cn1.[Na] |
| InChI | InChI=1S/C20H27N5O3S.Na/c1-24-13-16(12-22-24)25(9-8-21)29(27,28)23-20(26)11-19-17-6-2-4-14(17)10-15-5-3-7-18(15)19;/h10,12-13H,2-9,11,21H2,1H3,(H,23,26); |
| InChIKey | BEOFNHLQYIUTKX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |