About CID 155390020
CID 155390020 (PubChem CID 155390020) has the molecular formula C20H27N5NaO3S
and a molecular weight of 440.53 g/mol.
Molecular Properties
| Compound Name | CID 155390020 |
| PubChem CID | 155390020 |
| Molecular Formula | C20H27N5NaO3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | — |
| SMILES | Cn1cc(N(CCN)S(=O)(=O)NC(=O)Cc2c3c(cc4c2CCC4)CCC3)cn1.[Na] |
| InChI | InChI=1S/C20H27N5O3S.Na/c1-24-13-16(12-22-24)25(9-8-21)29(27,28)23-20(26)11-19-17-6-2-4-14(17)10-15-5-3-7-18(15)19;/h10,12-13H,2-9,11,21H2,1H3,(H,23,26); |
| InChIKey | BEOFNHLQYIUTKX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 155390020 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155390020?
The IUPAC name of CID 155390020 (CID 155390020) is not available.
What is the SMILES notation for CID 155390020?
The canonical SMILES for CID 155390020 is Cn1cc(N(CCN)S(=O)(=O)NC(=O)Cc2c3c(cc4c2CCC4)CCC3)cn1.[Na].
What is the InChIKey of CID 155390020?
The InChIKey is BEOFNHLQYIUTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N5O3S.Na/c1-24-13-16(12-22-24)25(9-8-21)29(27,28)23-20(26)11-19-17-6-2-4-14(17)10-15-5-3-7-18(15)19;/h10,12-13H,2-9,11,21H2,1H3,(H,23,26);.
What are the key properties of CID 155390020?
CID 155390020 has a molecular weight of 440.53 g/mol, XLogP of 0.39, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155390020 is sourced from PubChem (CID 155390020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).