C23H31N5NaO3S — CID 155388725
CID 155388725 (PubChem CID 155388725) has the molecular formula C23H31N5NaO3S and a molecular weight of 480.59 g/mol.
| Compound Name | CID 155388725 |
|---|---|
| PubChem CID | 155388725 |
| Molecular Formula | C23H31N5NaO3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | — |
| SMILES | Cn1cc(N(C2CCCNC2)S(=O)(=O)NC(=O)Cc2c3c(cc4c2CCC4)CCC3)cn1.[Na] |
| InChI | InChI=1S/C23H31N5O3S.Na/c1-27-15-19(14-25-27)28(18-7-4-10-24-13-18)32(30,31)26-23(29)12-22-20-8-2-5-16(20)11-17-6-3-9-21(17)22;/h11,14-15,18,24H,2-10,12-13H2,1H3,(H,26,29); |
| InChIKey | LCYGNACMNUNQSW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |