About CID 161330057
CID 161330057 (PubChem CID 161330057) has the molecular formula C7H10BBrN
and a molecular weight of 198.88 g/mol.
Molecular Properties
| Compound Name | CID 161330057 |
| PubChem CID | 161330057 |
| Molecular Formula | C7H10BBrN |
| Molecular Weight | 198.88 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | — |
| SMILES | CCN1C=CC=CC1Br.[B] |
| InChI | InChI=1S/C7H10BrN.B/c1-2-9-6-4-3-5-7(9)8;/h3-7H,2H2,1H3; |
| InChIKey | VLHJIIKAIZJFRY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.88 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 161330057 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161330057?
The IUPAC name of CID 161330057 (CID 161330057) is not available.
What is the SMILES notation for CID 161330057?
The canonical SMILES for CID 161330057 is CCN1C=CC=CC1Br.[B].
What is the InChIKey of CID 161330057?
The InChIKey is VLHJIIKAIZJFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN.B/c1-2-9-6-4-3-5-7(9)8;/h3-7H,2H2,1H3;.
What are the key properties of CID 161330057?
CID 161330057 has a molecular weight of 198.88 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161330057 is sourced from PubChem (CID 161330057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).