C31H35N5O7 — CID 161330824
N-[(2S)-3-hydroxy-1-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]-1H-indole-2-carboxamide;quinoline-2-carboxylic acid (PubChem CID 161330824) has the molecular formula C31H35N5O7 and a molecular weight of 589.65 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]-1H-indole-2-carboxamide;quinoline-2-carboxylic acid.
| Compound Name | N-[(2S)-3-hydroxy-1-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]-1H-indole-2-carboxamide;quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 161330824 |
| Molecular Formula | C31H35N5O7 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-1-oxopropan-2-yl]-1H-indole-2-carboxamide;quinoline-2-carboxylic acid |
| SMILES | O=C(CCCC1CCN(C(=O)[C@H](CO)NC(=O)c2cc3ccccc3[nH]2)CC1)NO.O=C(O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H28N4O5.C10H7NO2/c26-13-18(23-20(28)17-12-15-5-1-2-6-16(15)22-17)21(29)25-10-8-14(9-11-25)4-3-7-19(27)24-30;12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-2,5-6,12,14,18,22,26,30H,3-4,7-11,13H2,(H,23,28)(H,24,27);1-6H,(H,12,13)/t18-;/m0./s1 |
| InChIKey | VLJWIVSIRABKMT-FERBBOLQSA-N |
| XLogP | 3.11 |
| TPSA | 184.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|