C19H25N3O3 — CID 3618702
N-[1-(cyclohexylmethylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-indole-2-carboxamide (PubChem CID 3618702) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[1-(cyclohexylmethylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[1-(cyclohexylmethylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 3618702 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[1-(cyclohexylmethylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC(CO)C(=O)NCC1CCCCC1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H25N3O3/c23-12-17(18(24)20-11-13-6-2-1-3-7-13)22-19(25)16-10-14-8-4-5-9-15(14)21-16/h4-5,8-10,13,17,21,23H,1-3,6-7,11-12H2,(H,20,24)(H,22,25) |
| InChIKey | DOILFBCFSPJWIQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |