C26H37N3O4 — CID 57263044
2-[3-cyclohexylpropyl-[(2S)-2-(1H-indole-2-carbonylamino)hexanoyl]amino]acetic acid (PubChem CID 57263044) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[3-cyclohexylpropyl-[(2S)-2-(1H-indole-2-carbonylamino)hexanoyl]amino]acetic acid.
| Compound Name | 2-[3-cyclohexylpropyl-[(2S)-2-(1H-indole-2-carbonylamino)hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 57263044 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 2-[3-cyclohexylpropyl-[(2S)-2-(1H-indole-2-carbonylamino)hexanoyl]amino]acetic acid |
| SMILES | CCCC[C@H](NC(=O)c1cc2ccccc2[nH]1)C(=O)N(CCCC1CCCCC1)CC(=O)O |
| InChI | InChI=1S/C26H37N3O4/c1-2-3-14-22(28-25(32)23-17-20-13-7-8-15-21(20)27-23)26(33)29(18-24(30)31)16-9-12-19-10-5-4-6-11-19/h7-8,13,15,17,19,22,27H,2-6,9-12,14,16,18H2,1H3,(H,28,32)(H,30,31)/t22-/m0/s1 |
| InChIKey | PWPZLFCBSXPFRW-QFIPXVFZSA-N |
| XLogP | 4.73 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |