C20H27N3O4 — CID 14720390
(4R)-5-(dipropylamino)-4-(1H-indole-2-carbonylamino)-5-oxopentanoic acid (PubChem CID 14720390) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is (4R)-5-(dipropylamino)-4-(1H-indole-2-carbonylamino)-5-oxopentanoic acid.
| Compound Name | (4R)-5-(dipropylamino)-4-(1H-indole-2-carbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 14720390 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (4R)-5-(dipropylamino)-4-(1H-indole-2-carbonylamino)-5-oxopentanoic acid |
| SMILES | CCCN(CCC)C(=O)[C@@H](CCC(=O)O)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H27N3O4/c1-3-11-23(12-4-2)20(27)16(9-10-18(24)25)22-19(26)17-13-14-7-5-6-8-15(14)21-17/h5-8,13,16,21H,3-4,9-12H2,1-2H3,(H,22,26)(H,24,25)/t16-/m1/s1 |
| InChIKey | XKEPEJGXYZMKLY-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |