About N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide
N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide (PubChem CID 5171439) has the molecular formula C15H14N4O3S
and a molecular weight of 330.37 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide |
| PubChem CID | 5171439 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC(CO)C(=O)Nc1nccs1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H14N4O3S/c20-8-12(14(22)19-15-16-5-6-23-15)18-13(21)11-7-9-3-1-2-4-10(9)17-11/h1-7,12,17,20H,8H2,(H,18,21)(H,16,19,22) |
| InChIKey | HACBMQXHJZNYKQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide?
The IUPAC name of N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide (CID 5171439) is N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide.
What is the SMILES notation for N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide?
The canonical SMILES for N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide is O=C(NC(CO)C(=O)Nc1nccs1)c1cc2ccccc2[nH]1.
What is the InChIKey of N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide?
The InChIKey is HACBMQXHJZNYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O3S/c20-8-12(14(22)19-15-16-5-6-23-15)18-13(21)11-7-9-3-1-2-4-10(9)17-11/h1-7,12,17,20H,8H2,(H,18,21)(H,16,19,22).
What are the key properties of N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide?
N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide has a molecular weight of 330.37 g/mol, XLogP of 1.35, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-1H-indole-2-carboxamide is sourced from PubChem (CID 5171439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).