About 2,2-dimethylpyrrole;ethane
2,2-dimethylpyrrole;ethane (PubChem CID 161331479) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 2,2-dimethylpyrrole;ethane.
Molecular Properties
| Compound Name | 2,2-dimethylpyrrole;ethane |
| PubChem CID | 161331479 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 2,2-dimethylpyrrole;ethane |
| SMILES | CC.CC.CC1(C)C=CC=N1 |
| InChI | InChI=1S/C6H9N.2C2H6/c1-6(2)4-3-5-7-6;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | VLLYWSNJHGPROC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylpyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpyrrole;ethane?
The IUPAC name of 2,2-dimethylpyrrole;ethane (CID 161331479) is 2,2-dimethylpyrrole;ethane.
What is the SMILES notation for 2,2-dimethylpyrrole;ethane?
The canonical SMILES for 2,2-dimethylpyrrole;ethane is CC.CC.CC1(C)C=CC=N1.
What is the InChIKey of 2,2-dimethylpyrrole;ethane?
The InChIKey is VLLYWSNJHGPROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.2C2H6/c1-6(2)4-3-5-7-6;2*1-2/h3-5H,1-2H3;2*1-2H3.
What are the key properties of 2,2-dimethylpyrrole;ethane?
2,2-dimethylpyrrole;ethane has a molecular weight of 155.28 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpyrrole;ethane is sourced from PubChem (CID 161331479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).