C25H18Cl2F3NO7 — CID 161334237
[(2R,3S,5R)-3-(4-chlorobenzoyl)oxy-5-[2,4-dioxo-5-(trifluoromethyl)-1-pyridinyl]oxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 161334237) has the molecular formula C25H18Cl2F3NO7 and a molecular weight of 572.32 g/mol. Its IUPAC name is [(2R,3S,5R)-3-(4-chlorobenzoyl)oxy-5-[2,4-dioxo-5-(trifluoromethyl)-1-pyridinyl]oxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2R,3S,5R)-3-(4-chlorobenzoyl)oxy-5-[2,4-dioxo-5-(trifluoromethyl)-1-pyridinyl]oxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 161334237 |
| Molecular Formula | C25H18Cl2F3NO7 |
| Molecular Weight | 572.32 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | [(2R,3S,5R)-3-(4-chlorobenzoyl)oxy-5-[2,4-dioxo-5-(trifluoromethyl)-1-pyridinyl]oxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | O=C1CC(=O)N([C@H]2C[C@H](OC(=O)c3ccc(Cl)cc3)[C@@H](COC(=O)c3ccc(Cl)cc3)O2)C=C1C(F)(F)F |
| InChI | InChI=1S/C25H18Cl2F3NO7/c26-15-5-1-13(2-6-15)23(34)36-12-20-19(38-24(35)14-3-7-16(27)8-4-14)10-22(37-20)31-11-17(25(28,29)30)18(32)9-21(31)33/h1-8,11,19-20,22H,9-10,12H2/t19-,20+,22+/m0/s1 |
| InChIKey | JZULFLTZSMUBNB-TUNNFDKTSA-N |
| XLogP | 4.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|