C19H21BrN4O3 — CID 161335103
2-[4-[(3-amino-5-bromobenzoyl)amino]cyclohexyl]oxypyridine-3-carboxamide (PubChem CID 161335103) has the molecular formula C19H21BrN4O3 and a molecular weight of 433.31 g/mol. Its IUPAC name is 2-[4-[(3-amino-5-bromobenzoyl)amino]cyclohexyl]oxypyridine-3-carboxamide.
| Compound Name | 2-[4-[(3-amino-5-bromobenzoyl)amino]cyclohexyl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 161335103 |
| Molecular Formula | C19H21BrN4O3 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[4-[(3-amino-5-bromobenzoyl)amino]cyclohexyl]oxypyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1OC1CCC(NC(=O)c2cc(N)cc(Br)c2)CC1 |
| InChI | InChI=1S/C19H21BrN4O3/c20-12-8-11(9-13(21)10-12)18(26)24-14-3-5-15(6-4-14)27-19-16(17(22)25)2-1-7-23-19/h1-2,7-10,14-15H,3-6,21H2,(H2,22,25)(H,24,26) |
| InChIKey | VLXSYBZNHIYBDQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|