C54H82N4O6 — CID 161335511
N-cyclohexyl-4-hex-5-enyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;N-cyclohexyl-4-hexyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide (PubChem CID 161335511) has the molecular formula C54H82N4O6 and a molecular weight of 883.27 g/mol. Its IUPAC name is N-cyclohexyl-4-hex-5-enyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;N-cyclohexyl-4-hexyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-cyclohexyl-4-hex-5-enyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;N-cyclohexyl-4-hexyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 161335511 |
| Molecular Formula | C54H82N4O6 |
| Molecular Weight | 883.27 g/mol |
| Exact Mass | 882.62 |
| IUPAC Name | N-cyclohexyl-4-hex-5-enyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide;N-cyclohexyl-4-hexyl-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide |
| SMILES | C=CCCCCN1C(=O)C(C)(C)Oc2cc(C)c(C(=O)N(C(C)C)C3CCCCC3)cc21.CCCCCCN1C(=O)C(C)(C)Oc2cc(C)c(C(=O)N(C(C)C)C3CCCCC3)cc21 |
| InChI | InChI=1S/C27H42N2O3.C27H40N2O3/c2*1-7-8-9-13-16-28-23-18-22(20(4)17-24(23)32-27(5,6)26(28)31)25(30)29(19(2)3)21-14-11-10-12-15-21/h17-19,21H,7-16H2,1-6H3;7,17-19,21H,1,8-16H2,2-6H3 |
| InChIKey | VLZFIDODZWGLPJ-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.27 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|