About 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde
3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde (PubChem CID 161348145) has the molecular formula C12H12F2N4O3
and a molecular weight of 298.25 g/mol. Its IUPAC name is 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde |
| PubChem CID | 161348145 |
| Molecular Formula | C12H12F2N4O3 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde |
| SMILES | COc1ccc(C(F)F)nn1.COc1ccc(C=O)nn1 |
| InChI | InChI=1S/C6H6F2N2O.C6H6N2O2/c1-11-5-3-2-4(6(7)8)9-10-5;1-10-6-3-2-5(4-9)7-8-6/h2-3,6H,1H3;2-4H,1H3 |
| InChIKey | VNORKANDAFGCRV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde?
The IUPAC name of 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde (CID 161348145) is 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde.
What is the SMILES notation for 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde?
The canonical SMILES for 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde is COc1ccc(C(F)F)nn1.COc1ccc(C=O)nn1.
What is the InChIKey of 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde?
The InChIKey is VNORKANDAFGCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O.C6H6N2O2/c1-11-5-3-2-4(6(7)8)9-10-5;1-10-6-3-2-5(4-9)7-8-6/h2-3,6H,1H3;2-4H,1H3.
What are the key properties of 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde?
3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde has a molecular weight of 298.25 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-6-methoxypyridazine;6-methoxypyridazine-3-carbaldehyde is sourced from PubChem (CID 161348145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).