C14H20Cl2N2O8S2 — CID 161349596
ethyl 3-(chlorosulfonylamino)propanoate;methyl 4-[(chlorosulfonylamino)methyl]benzoate (PubChem CID 161349596) has the molecular formula C14H20Cl2N2O8S2 and a molecular weight of 479.36 g/mol. Its IUPAC name is ethyl 3-(chlorosulfonylamino)propanoate;methyl 4-[(chlorosulfonylamino)methyl]benzoate.
| Compound Name | ethyl 3-(chlorosulfonylamino)propanoate;methyl 4-[(chlorosulfonylamino)methyl]benzoate |
|---|---|
| PubChem CID | 161349596 |
| Molecular Formula | C14H20Cl2N2O8S2 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | ethyl 3-(chlorosulfonylamino)propanoate;methyl 4-[(chlorosulfonylamino)methyl]benzoate |
| SMILES | CCOC(=O)CCNS(=O)(=O)Cl.COC(=O)c1ccc(CNS(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C9H10ClNO4S.C5H10ClNO4S/c1-15-9(12)8-4-2-7(3-5-8)6-11-16(10,13)14;1-2-11-5(8)3-4-7-12(6,9)10/h2-5,11H,6H2,1H3;7H,2-4H2,1H3 |
| InChIKey | VNTJKLAGLQYEKN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |