C13H13IO3 — CID 161350114
ethyl 2-(5-iodo-6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 161350114) has the molecular formula C13H13IO3 and a molecular weight of 344.15 g/mol. Its IUPAC name is ethyl 2-(5-iodo-6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | ethyl 2-(5-iodo-6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 161350114 |
| Molecular Formula | C13H13IO3 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | ethyl 2-(5-iodo-6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | CCOC(=O)Cc1coc2cc(C)c(I)cc12 |
| InChI | InChI=1S/C13H13IO3/c1-3-16-13(15)5-9-7-17-12-4-8(2)11(14)6-10(9)12/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | MDBYZVOZUKXUHC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|