C26H23NO3 — CID 162195258
ethyl 2-[6-(benzhydrylideneamino)-5-methyl-1-benzofuran-3-yl]acetate (PubChem CID 162195258) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is ethyl 2-[6-(benzhydrylideneamino)-5-methyl-1-benzofuran-3-yl]acetate.
| Compound Name | ethyl 2-[6-(benzhydrylideneamino)-5-methyl-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 162195258 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | ethyl 2-[6-(benzhydrylideneamino)-5-methyl-1-benzofuran-3-yl]acetate |
| SMILES | CCOC(=O)Cc1coc2cc(N=C(c3ccccc3)c3ccccc3)c(C)cc12 |
| InChI | InChI=1S/C26H23NO3/c1-3-29-25(28)15-21-17-30-24-16-23(18(2)14-22(21)24)27-26(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-14,16-17H,3,15H2,1-2H3 |
| InChIKey | OYBAQKLNJKLYFW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|