C11H16ClF3N4 — CID 161351498
N-methyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-4-amine;hydrochloride (PubChem CID 161351498) has the molecular formula C11H16ClF3N4 and a molecular weight of 296.72 g/mol. Its IUPAC name is N-methyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-4-amine;hydrochloride.
| Compound Name | N-methyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 161351498 |
| Molecular Formula | C11H16ClF3N4 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-methyl-1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-4-amine;hydrochloride |
| SMILES | CNC1CCN(c2cnc(C(F)(F)F)cn2)CC1.Cl |
| InChI | InChI=1S/C11H15F3N4.ClH/c1-15-8-2-4-18(5-3-8)10-7-16-9(6-17-10)11(12,13)14;/h6-8,15H,2-5H2,1H3;1H |
| InChIKey | JZZPGAGESIRKMQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |