C16H21NO5 — CID 161352808
cyclopentanecarboxylic acid;2-formamido-2-phenylpropanoic acid (PubChem CID 161352808) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is cyclopentanecarboxylic acid;2-formamido-2-phenylpropanoic acid.
| Compound Name | cyclopentanecarboxylic acid;2-formamido-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 161352808 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | cyclopentanecarboxylic acid;2-formamido-2-phenylpropanoic acid |
| SMILES | CC(NC=O)(C(=O)O)c1ccccc1.O=C(O)C1CCCC1 |
| InChI | InChI=1S/C10H11NO3.C6H10O2/c1-10(9(13)14,11-7-12)8-5-3-2-4-6-8;7-6(8)5-3-1-2-4-5/h2-7H,1H3,(H,11,12)(H,13,14);5H,1-4H2,(H,7,8) |
| InChIKey | VODJTKWMIHNFLW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|