About 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol)
2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) (PubChem CID 161354189) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol).
Molecular Properties
| Compound Name | 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) |
| PubChem CID | 161354189 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) |
| SMILES | CC(C)O.CC(C)O.Cc1ccccc1-n1c(C)nccc1=O |
| InChI | InChI=1S/C12H12N2O.2C3H8O/c1-9-5-3-4-6-11(9)14-10(2)13-8-7-12(14)15;2*1-3(2)4/h3-8H,1-2H3;2*3-4H,1-2H3 |
| InChIKey | VOHYORFXRQINRH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol)?
The IUPAC name of 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) (CID 161354189) is 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol).
What is the SMILES notation for 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol)?
The canonical SMILES for 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) is CC(C)O.CC(C)O.Cc1ccccc1-n1c(C)nccc1=O.
What is the InChIKey of 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol)?
The InChIKey is VOHYORFXRQINRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O.2C3H8O/c1-9-5-3-4-6-11(9)14-10(2)13-8-7-12(14)15;2*1-3(2)4/h3-8H,1-2H3;2*3-4H,1-2H3.
What are the key properties of 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol)?
2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) has a molecular weight of 320.43 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2-methylphenyl)pyrimidin-4-one;bis(propan-2-ol) is sourced from PubChem (CID 161354189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).