C44H40N2Si — CID 161355015
[3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]-trimethylsilane;methane (PubChem CID 161355015) has the molecular formula C44H40N2Si and a molecular weight of 624.90 g/mol. Its IUPAC name is [3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]-trimethylsilane;methane.
| Compound Name | [3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]-trimethylsilane;methane |
|---|---|
| PubChem CID | 161355015 |
| Molecular Formula | C44H40N2Si |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | [3,5-bis[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]-trimethylsilane;methane |
| SMILES | C.C[Si](C)(C)c1cc(-c2ccccc2-c2ccc(-c3ccccn3)cc2)cc(-c2ccccc2-c2ccc(-c3ccccn3)cc2)c1 |
| InChI | InChI=1S/C43H36N2Si.CH4/c1-46(2,3)37-29-35(40-14-6-4-12-38(40)31-18-22-33(23-19-31)42-16-8-10-26-44-42)28-36(30-37)41-15-7-5-13-39(41)32-20-24-34(25-21-32)43-17-9-11-27-45-43;/h4-30H,1-3H3;1H4 |
| InChIKey | VOKRDBDWJNUVIW-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|