C58H51N3Si — CID 165148525
[4-[2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]-trimethylsilane (PubChem CID 165148525) has the molecular formula C58H51N3Si and a molecular weight of 818.15 g/mol. Its IUPAC name is [4-[2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]-trimethylsilane.
| Compound Name | [4-[2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 165148525 |
| Molecular Formula | C58H51N3Si |
| Molecular Weight | 818.15 g/mol |
| Exact Mass | 817.39 |
| IUPAC Name | [4-[2-[4-[2-[3,5-bis[2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccnc(-c3ccc(-c4ccccc4-c4cc(CCc5ccc(-c6ccccn6)cc5)cc(CCc5ccc(-c6ccccn6)cc5)c4)cc3)c2)cc1 |
| InChI | InChI=1S/C58H51N3Si/c1-62(2,3)53-32-30-46(31-33-53)51-34-37-61-58(41-51)50-28-26-47(27-29-50)54-10-4-5-11-55(54)52-39-44(16-14-42-18-22-48(23-19-42)56-12-6-8-35-59-56)38-45(40-52)17-15-43-20-24-49(25-21-43)57-13-7-9-36-60-57/h4-13,18-41H,14-17H2,1-3H3 |
| InChIKey | OLNNQNOTKIKHHF-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.15 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|