About 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride
2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 161355740) has the molecular formula C18H16BrClN2O2
and a molecular weight of 407.70 g/mol. Its IUPAC name is 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| PubChem CID | 161355740 |
| Molecular Formula | C18H16BrClN2O2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | COc1cc(Br)cc2cc(-c3ccccc3C3=NCCN3)oc12.Cl |
| InChI | InChI=1S/C18H15BrN2O2.ClH/c1-22-16-10-12(19)8-11-9-15(23-17(11)16)13-4-2-3-5-14(13)18-20-6-7-21-18;/h2-5,8-10H,6-7H2,1H3,(H,20,21);1H |
| InChIKey | VONBLRPOXYNCON-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride?
The IUPAC name of 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride (CID 161355740) is 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride.
What is the SMILES notation for 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride?
The canonical SMILES for 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride is COc1cc(Br)cc2cc(-c3ccccc3C3=NCCN3)oc12.Cl.
What is the InChIKey of 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride?
The InChIKey is VONBLRPOXYNCON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrN2O2.ClH/c1-22-16-10-12(19)8-11-9-15(23-17(11)16)13-4-2-3-5-14(13)18-20-6-7-21-18;/h2-5,8-10H,6-7H2,1H3,(H,20,21);1H.
What are the key properties of 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride?
2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride has a molecular weight of 407.70 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5-bromo-7-methoxy-1-benzofuran-2-yl)phenyl]-4,5-dihydro-1H-imidazole;hydrochloride is sourced from PubChem (CID 161355740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).