C35H48Si2 — CID 161357993
diethyl-methyl-[4-[(E)-1-[3-[(Z)-1-(4-triethylsilylphenyl)prop-1-enyl]phenyl]prop-1-enyl]phenyl]silane (PubChem CID 161357993) has the molecular formula C35H48Si2 and a molecular weight of 524.94 g/mol. Its IUPAC name is diethyl-methyl-[4-[(E)-1-[3-[(Z)-1-(4-triethylsilylphenyl)prop-1-enyl]phenyl]prop-1-enyl]phenyl]silane.
| Compound Name | diethyl-methyl-[4-[(E)-1-[3-[(Z)-1-(4-triethylsilylphenyl)prop-1-enyl]phenyl]prop-1-enyl]phenyl]silane |
|---|---|
| PubChem CID | 161357993 |
| Molecular Formula | C35H48Si2 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | diethyl-methyl-[4-[(E)-1-[3-[(Z)-1-(4-triethylsilylphenyl)prop-1-enyl]phenyl]prop-1-enyl]phenyl]silane |
| SMILES | C/C=C(/c1ccc([Si](CC)(CC)CC)cc1)c1cccc(/C(=C/C)c2ccc([Si](C)(CC)CC)cc2)c1 |
| InChI | InChI=1S/C35H48Si2/c1-9-34(28-19-23-32(24-20-28)36(8,11-3)12-4)30-17-16-18-31(27-30)35(10-2)29-21-25-33(26-22-29)37(13-5,14-6)15-7/h9-10,16-27H,11-15H2,1-8H3/b34-9+,35-10- |
| InChIKey | LJTSXNNOJXODHG-SZSZOVBKSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|