C39H37N3Si — CID 176645706
[4-[6-[6-(4,6-diphenyl-2-pyridinyl)-2-pyridinyl]-2-pyridinyl]phenyl]-triethylsilane (PubChem CID 176645706) has the molecular formula C39H37N3Si and a molecular weight of 575.83 g/mol. Its IUPAC name is [4-[6-[6-(4,6-diphenyl-2-pyridinyl)-2-pyridinyl]-2-pyridinyl]phenyl]-triethylsilane.
| Compound Name | [4-[6-[6-(4,6-diphenyl-2-pyridinyl)-2-pyridinyl]-2-pyridinyl]phenyl]-triethylsilane |
|---|---|
| PubChem CID | 176645706 |
| Molecular Formula | C39H37N3Si |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [4-[6-[6-(4,6-diphenyl-2-pyridinyl)-2-pyridinyl]-2-pyridinyl]phenyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1ccc(-c2cccc(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)n3)n2)cc1 |
| InChI | InChI=1S/C39H37N3Si/c1-4-43(5-2,6-3)33-25-23-31(24-26-33)34-19-13-20-35(40-34)36-21-14-22-37(41-36)39-28-32(29-15-9-7-10-16-29)27-38(42-39)30-17-11-8-12-18-30/h7-28H,4-6H2,1-3H3 |
| InChIKey | OQEDHLUJDAENEV-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|