C54H53NSi2 — CID 176645612
triethyl-[4-[2-naphthalen-1-yl-6-[4-[4-[2-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]silane (PubChem CID 176645612) has the molecular formula C54H53NSi2 and a molecular weight of 772.20 g/mol. Its IUPAC name is triethyl-[4-[2-naphthalen-1-yl-6-[4-[4-[2-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]silane.
| Compound Name | triethyl-[4-[2-naphthalen-1-yl-6-[4-[4-[2-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]silane |
|---|---|
| PubChem CID | 176645612 |
| Molecular Formula | C54H53NSi2 |
| Molecular Weight | 772.20 g/mol |
| Exact Mass | 771.37 |
| IUPAC Name | triethyl-[4-[2-naphthalen-1-yl-6-[4-[4-[2-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]-4-pyridinyl]phenyl]silane |
| SMILES | CC[Si](CC)(CC)c1ccc(-c2cc(-c3ccc(-c4ccc(-c5ccccc5-c5ccc([Si](C)(C)C)cc5)cc4)cc3)nc(-c3cccc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C54H53NSi2/c1-7-57(8-2,9-3)48-35-29-41(30-36-48)46-37-53(55-54(38-46)52-20-14-16-42-15-10-11-19-51(42)52)45-27-23-40(24-28-45)39-21-25-43(26-22-39)49-17-12-13-18-50(49)44-31-33-47(34-32-44)56(4,5)6/h10-38H,7-9H2,1-6H3 |
| InChIKey | CCOYEWBUGCZVTI-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.20 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|