About methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate
methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate (PubChem CID 161358778) has the molecular formula C22H28Br2N2O4
and a molecular weight of 544.28 g/mol. Its IUPAC name is methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate.
Molecular Properties
| Compound Name | methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate |
| PubChem CID | 161358778 |
| Molecular Formula | C22H28Br2N2O4 |
| Molecular Weight | 544.28 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate |
| SMILES | COC(=O)C(CBr)CBr.COC(=O)C(CNc1ccccc1)CNc1ccccc1 |
| InChI | InChI=1S/C17H20N2O2.C5H8Br2O2/c1-21-17(20)14(12-18-15-8-4-2-5-9-15)13-19-16-10-6-3-7-11-16;1-9-5(8)4(2-6)3-7/h2-11,14,18-19H,12-13H2,1H3;4H,2-3H2,1H3 |
| InChIKey | VOWWNNIATQHUGV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate?
The IUPAC name of methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate (CID 161358778) is methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate.
What is the SMILES notation for methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate?
The canonical SMILES for methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate is COC(=O)C(CBr)CBr.COC(=O)C(CNc1ccccc1)CNc1ccccc1.
What is the InChIKey of methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate?
The InChIKey is VOWWNNIATQHUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2.C5H8Br2O2/c1-21-17(20)14(12-18-15-8-4-2-5-9-15)13-19-16-10-6-3-7-11-16;1-9-5(8)4(2-6)3-7/h2-11,14,18-19H,12-13H2,1H3;4H,2-3H2,1H3.
What are the key properties of methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate?
methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate has a molecular weight of 544.28 g/mol, XLogP of 4.57, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-anilino-2-(anilinomethyl)propanoate;methyl 3-bromo-2-(bromomethyl)propanoate is sourced from PubChem (CID 161358778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).