C22H40O3 — CID 161362311
ethyl 4,4,5-trimethylhept-6-enoate;4,4,5-trimethylhept-6-enal (PubChem CID 161362311) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is ethyl 4,4,5-trimethylhept-6-enoate;4,4,5-trimethylhept-6-enal.
| Compound Name | ethyl 4,4,5-trimethylhept-6-enoate;4,4,5-trimethylhept-6-enal |
|---|---|
| PubChem CID | 161362311 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | ethyl 4,4,5-trimethylhept-6-enoate;4,4,5-trimethylhept-6-enal |
| SMILES | C=CC(C)C(C)(C)CCC(=O)OCC.C=CC(C)C(C)(C)CCC=O |
| InChI | InChI=1S/C12H22O2.C10H18O/c1-6-10(3)12(4,5)9-8-11(13)14-7-2;1-5-9(2)10(3,4)7-6-8-11/h6,10H,1,7-9H2,2-5H3;5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | VPIPLISKNWSPDP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|