methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate

C10H16O2 — CID 549161

IUPACmethyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate
SMILESC=CC(C)C1(C)CC1C(=O)OC
InChIInChI=1S/C10H16O2/c1-5-7(2)10(3)6-8(10)9(11)12-4/h5,7-8H,1,6H2,2-4H3
InChIKeyAGVWMDPIMZFFEY-UHFFFAOYSA-N
MW168.24 g/mol
LogP2.01
Rot. Bonds3

About methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate

methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate (PubChem CID 549161) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate
PubChem CID549161
Molecular FormulaC10H16O2
Molecular Weight168.24 g/mol
Exact Mass168.12
IUPAC Namemethyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate
SMILESC=CC(C)C1(C)CC1C(=O)OC
InChIInChI=1S/C10H16O2/c1-5-7(2)10(3)6-8(10)9(11)12-4/h5,7-8H,1,6H2,2-4H3
InChIKeyAGVWMDPIMZFFEY-UHFFFAOYSA-N
XLogP2.01
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.24
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate?
The IUPAC name of methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate (CID 549161) is methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate?
The canonical SMILES for methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate is C=CC(C)C1(C)CC1C(=O)OC.
What is the InChIKey of methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate?
The InChIKey is AGVWMDPIMZFFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-5-7(2)10(3)6-8(10)9(11)12-4/h5,7-8H,1,6H2,2-4H3.
What are the key properties of methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate?
methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate has a molecular weight of 168.24 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-but-3-en-2-yl-2-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 549161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).