About ethyl formate;2-hexylcyclopentan-1-ol
ethyl formate;2-hexylcyclopentan-1-ol (PubChem CID 161366289) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is ethyl formate;2-hexylcyclopentan-1-ol.
Molecular Properties
| Compound Name | ethyl formate;2-hexylcyclopentan-1-ol |
| PubChem CID | 161366289 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | ethyl formate;2-hexylcyclopentan-1-ol |
| SMILES | CCCCCCC1CCCC1O.CCOC=O |
| InChI | InChI=1S/C11H22O.C3H6O2/c1-2-3-4-5-7-10-8-6-9-11(10)12;1-2-5-3-4/h10-12H,2-9H2,1H3;3H,2H2,1H3 |
| InChIKey | VPVXOTGDTLADQW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;2-hexylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;2-hexylcyclopentan-1-ol?
The IUPAC name of ethyl formate;2-hexylcyclopentan-1-ol (CID 161366289) is ethyl formate;2-hexylcyclopentan-1-ol.
What is the SMILES notation for ethyl formate;2-hexylcyclopentan-1-ol?
The canonical SMILES for ethyl formate;2-hexylcyclopentan-1-ol is CCCCCCC1CCCC1O.CCOC=O.
What is the InChIKey of ethyl formate;2-hexylcyclopentan-1-ol?
The InChIKey is VPVXOTGDTLADQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C3H6O2/c1-2-3-4-5-7-10-8-6-9-11(10)12;1-2-5-3-4/h10-12H,2-9H2,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;2-hexylcyclopentan-1-ol?
ethyl formate;2-hexylcyclopentan-1-ol has a molecular weight of 244.37 g/mol, XLogP of 3.30, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;2-hexylcyclopentan-1-ol is sourced from PubChem (CID 161366289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).