C17H32O2Si — CID 161367017
3-ethylpent-1-yn-3-ol;3-ethyl-1-trimethylsilylpent-1-yn-3-ol (PubChem CID 161367017) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is 3-ethylpent-1-yn-3-ol;3-ethyl-1-trimethylsilylpent-1-yn-3-ol.
| Compound Name | 3-ethylpent-1-yn-3-ol;3-ethyl-1-trimethylsilylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 161367017 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 3-ethylpent-1-yn-3-ol;3-ethyl-1-trimethylsilylpent-1-yn-3-ol |
| SMILES | C#CC(O)(CC)CC.CCC(O)(C#C[Si](C)(C)C)CC |
| InChI | InChI=1S/C10H20OSi.C7H12O/c1-6-10(11,7-2)8-9-12(3,4)5;1-4-7(8,5-2)6-3/h11H,6-7H2,1-5H3;1,8H,5-6H2,2-3H3 |
| InChIKey | VPYFEXXVCNLPPW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|