C20H38O2Si — CID 165029411
tert-butyl-dimethyl-(2-methylhex-5-yn-2-yloxy)silane;2-methylhex-5-yn-2-ol (PubChem CID 165029411) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2-methylhex-5-yn-2-yloxy)silane;2-methylhex-5-yn-2-ol.
| Compound Name | tert-butyl-dimethyl-(2-methylhex-5-yn-2-yloxy)silane;2-methylhex-5-yn-2-ol |
|---|---|
| PubChem CID | 165029411 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | tert-butyl-dimethyl-(2-methylhex-5-yn-2-yloxy)silane;2-methylhex-5-yn-2-ol |
| SMILES | C#CCCC(C)(C)O.C#CCCC(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26OSi.C7H12O/c1-9-10-11-13(5,6)14-15(7,8)12(2,3)4;1-4-5-6-7(2,3)8/h1H,10-11H2,2-8H3;1,8H,5-6H2,2-3H3 |
| InChIKey | MKHASBFSJBABOF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|