C26H24FNO5S — CID 161367741
7-[3-[(4-fluorophenyl)methylsulfonyl]-5-morpholin-4-ylphenyl]-4H-chromen-3-one (PubChem CID 161367741) has the molecular formula C26H24FNO5S and a molecular weight of 481.55 g/mol. Its IUPAC name is 7-[3-[(4-fluorophenyl)methylsulfonyl]-5-morpholin-4-ylphenyl]-4H-chromen-3-one.
| Compound Name | 7-[3-[(4-fluorophenyl)methylsulfonyl]-5-morpholin-4-ylphenyl]-4H-chromen-3-one |
|---|---|
| PubChem CID | 161367741 |
| Molecular Formula | C26H24FNO5S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 7-[3-[(4-fluorophenyl)methylsulfonyl]-5-morpholin-4-ylphenyl]-4H-chromen-3-one |
| SMILES | O=C1COc2cc(-c3cc(N4CCOCC4)cc(S(=O)(=O)Cc4ccc(F)cc4)c3)ccc2C1 |
| InChI | InChI=1S/C26H24FNO5S/c27-22-5-1-18(2-6-22)17-34(30,31)25-13-21(11-23(15-25)28-7-9-32-10-8-28)19-3-4-20-12-24(29)16-33-26(20)14-19/h1-6,11,13-15H,7-10,12,16-17H2 |
| InChIKey | VQAQXGIDHPELLM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |