C22H21NO3S — CID 161370423
4-[(5-methyl-2-pyridinyl)sulfonyl]-1-(4-phenylphenyl)butan-1-one (PubChem CID 161370423) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[(5-methyl-2-pyridinyl)sulfonyl]-1-(4-phenylphenyl)butan-1-one.
| Compound Name | 4-[(5-methyl-2-pyridinyl)sulfonyl]-1-(4-phenylphenyl)butan-1-one |
|---|---|
| PubChem CID | 161370423 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-[(5-methyl-2-pyridinyl)sulfonyl]-1-(4-phenylphenyl)butan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)CCCC(=O)c2ccc(-c3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C22H21NO3S/c1-17-9-14-22(23-16-17)27(25,26)15-5-8-21(24)20-12-10-19(11-13-20)18-6-3-2-4-7-18/h2-4,6-7,9-14,16H,5,8,15H2,1H3 |
| InChIKey | VQJSYJKYLNEDHF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |