C26H40O9 — CID 161374025
7-[2-[2-(5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one;2-prop-2-enoyloxyethyl prop-2-enoate (PubChem CID 161374025) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is 7-[2-[2-(5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one;2-prop-2-enoyloxyethyl prop-2-enoate.
| Compound Name | 7-[2-[2-(5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one;2-prop-2-enoyloxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 161374025 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 7-[2-[2-(5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one;2-prop-2-enoyloxyethyl prop-2-enoate |
| SMILES | C=CC(=O)CCCCOCCOCCOCCCCC(=O)C=C.C=CC(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C18H30O5.C8H10O4/c1-3-17(19)9-5-7-11-21-13-15-23-16-14-22-12-8-6-10-18(20)4-2;1-3-7(9)11-5-6-12-8(10)4-2/h3-4H,1-2,5-16H2;3-4H,1-2,5-6H2 |
| InChIKey | VQVNTRIBTHUCFH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|