About methyl 1-benzofuran-7-carboxylate;ozone
methyl 1-benzofuran-7-carboxylate;ozone (PubChem CID 161374548) has the molecular formula C10H8O6
and a molecular weight of 224.17 g/mol. Its IUPAC name is methyl 1-benzofuran-7-carboxylate;ozone.
Molecular Properties
| Compound Name | methyl 1-benzofuran-7-carboxylate;ozone |
| PubChem CID | 161374548 |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | methyl 1-benzofuran-7-carboxylate;ozone |
| SMILES | COC(=O)c1cccc2ccoc12.O=[O+][O-] |
| InChI | InChI=1S/C10H8O3.O3/c1-12-10(11)8-4-2-3-7-5-6-13-9(7)8;1-3-2/h2-6H,1H3; |
| InChIKey | VQXBRQKFMBDIFR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-benzofuran-7-carboxylate;ozone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-benzofuran-7-carboxylate;ozone?
The IUPAC name of methyl 1-benzofuran-7-carboxylate;ozone (CID 161374548) is methyl 1-benzofuran-7-carboxylate;ozone.
What is the SMILES notation for methyl 1-benzofuran-7-carboxylate;ozone?
The canonical SMILES for methyl 1-benzofuran-7-carboxylate;ozone is COC(=O)c1cccc2ccoc12.O=[O+][O-].
What is the InChIKey of methyl 1-benzofuran-7-carboxylate;ozone?
The InChIKey is VQXBRQKFMBDIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3.O3/c1-12-10(11)8-4-2-3-7-5-6-13-9(7)8;1-3-2/h2-6H,1H3;.
What are the key properties of methyl 1-benzofuran-7-carboxylate;ozone?
methyl 1-benzofuran-7-carboxylate;ozone has a molecular weight of 224.17 g/mol, XLogP of 1.10, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzofuran-7-carboxylate;ozone is sourced from PubChem (CID 161374548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).