C40H40N4O3 — CID 161377492
4-tert-butyl-N-(1-oxidoquinolin-1-ium-3-yl)benzamide;4-tert-butyl-N-quinolin-3-ylbenzamide (PubChem CID 161377492) has the molecular formula C40H40N4O3 and a molecular weight of 624.79 g/mol. Its IUPAC name is 4-tert-butyl-N-(1-oxidoquinolin-1-ium-3-yl)benzamide;4-tert-butyl-N-quinolin-3-ylbenzamide.
| Compound Name | 4-tert-butyl-N-(1-oxidoquinolin-1-ium-3-yl)benzamide;4-tert-butyl-N-quinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 161377492 |
| Molecular Formula | C40H40N4O3 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 4-tert-butyl-N-(1-oxidoquinolin-1-ium-3-yl)benzamide;4-tert-butyl-N-quinolin-3-ylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc3ccccc3[n+]([O-])c2)cc1.CC(C)(C)c1ccc(C(=O)Nc2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C20H20N2O2.C20H20N2O/c1-20(2,3)16-10-8-14(9-11-16)19(23)21-17-12-15-6-4-5-7-18(15)22(24)13-17;1-20(2,3)16-10-8-14(9-11-16)19(23)22-17-12-15-6-4-5-7-18(15)21-13-17/h4-13H,1-3H3,(H,21,23);4-13H,1-3H3,(H,22,23) |
| InChIKey | VRGNQSBCVVWSRP-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 98.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|