C8H23NO2 — CID 161381888
azanium;2,2-diethylbutan-1-ol;hydroxide (PubChem CID 161381888) has the molecular formula C8H23NO2 and a molecular weight of 165.28 g/mol. Its IUPAC name is azanium;2,2-diethylbutan-1-ol;hydroxide.
| Compound Name | azanium;2,2-diethylbutan-1-ol;hydroxide |
|---|---|
| PubChem CID | 161381888 |
| Molecular Formula | C8H23NO2 |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.17 |
| IUPAC Name | azanium;2,2-diethylbutan-1-ol;hydroxide |
| SMILES | CCC(CC)(CC)CO.[NH4+].[OH-] |
| InChI | InChI=1S/C8H18O.H3N.H2O/c1-4-8(5-2,6-3)7-9;;/h9H,4-7H2,1-3H3;1H3;1H2 |
| InChIKey | VRVCQADVLFETHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |