C17H36N2O4 — CID 161384591
tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;deuterioethane;2,2,6,6-tetradeuteriopiperidin-4-ol (PubChem CID 161384591) has the molecular formula C17H36N2O4 and a molecular weight of 341.54 g/mol. Its IUPAC name is tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;deuterioethane;2,2,6,6-tetradeuteriopiperidin-4-ol.
| Compound Name | tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;deuterioethane;2,2,6,6-tetradeuteriopiperidin-4-ol |
|---|---|
| PubChem CID | 161384591 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.32 |
| IUPAC Name | tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;deuterioethane;2,2,6,6-tetradeuteriopiperidin-4-ol |
| SMILES | [2H]C1([2H])CC(O)CC([2H])([2H])N1.[2H]C1([2H])CC(O)CC([2H])([2H])N1C(=O)OC(C)(C)C.[2H]CC |
| InChI | InChI=1S/C10H19NO3.C5H11NO.C2H6/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;7-5-1-3-6-4-2-5;1-2/h8,12H,4-7H2,1-3H3;5-7H,1-4H2;1-2H3/i6D2,7D2;3D2,4D2;1D |
| InChIKey | VSDZFLGLYDMEHV-KLDICAFSSA-N |
| XLogP | 2.14 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |