C13H20N2O3 — CID 161392447
trans-(1R,2R)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]cyclopentane-1-carboxylic acid (PubChem CID 161392447) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 161392447 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | trans-(1R,2R)-2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-yl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC[C@H]1N1C[C@@H]2CCCCN2C1=O |
| InChI | InChI=1S/C13H20N2O3/c16-12(17)10-5-3-6-11(10)15-8-9-4-1-2-7-14(9)13(15)18/h9-11H,1-8H2,(H,16,17)/t9-,10+,11+/m0/s1 |
| InChIKey | XLQKYLCVXYBONZ-HBNTYKKESA-N |
| XLogP | 1.53 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |