C16H21N5O5S — CID 161393454
[(2R,3R,5R)-5-ethyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxymethanethioic S-acid (PubChem CID 161393454) has the molecular formula C16H21N5O5S and a molecular weight of 395.44 g/mol. Its IUPAC name is [(2R,3R,5R)-5-ethyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxymethanethioic S-acid.
| Compound Name | [(2R,3R,5R)-5-ethyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxymethanethioic S-acid |
|---|---|
| PubChem CID | 161393454 |
| Molecular Formula | C16H21N5O5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [(2R,3R,5R)-5-ethyl-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl]oxymethanethioic S-acid |
| SMILES | CC[C@@H]1C[C@@H](OC(=O)S)[C@H](n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)O1 |
| InChI | InChI=1S/C16H21N5O5S/c1-4-8-5-9(26-16(24)27)14(25-8)21-6-17-10-11(21)18-15(20-13(10)23)19-12(22)7(2)3/h6-9,14H,4-5H2,1-3H3,(H,24,27)(H2,18,19,20,22,23)/t8-,9-,14-/m1/s1 |
| InChIKey | OLPHFBOPQBKYMN-RFXMVYNHSA-N |
| XLogP | 1.85 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|