About dibutyltin;furan-2,5-dione
dibutyltin;furan-2,5-dione (PubChem CID 161399584) has the molecular formula C12H20O3Sn
and a molecular weight of 331.00 g/mol. Its IUPAC name is dibutyltin;furan-2,5-dione.
Molecular Properties
| Compound Name | dibutyltin;furan-2,5-dione |
| PubChem CID | 161399584 |
| Molecular Formula | C12H20O3Sn |
| Molecular Weight | 331.00 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | dibutyltin;furan-2,5-dione |
| SMILES | CCCC[Sn]CCCC.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.2C4H9.Sn/c5-3-1-2-4(6)7-3;2*1-3-4-2;/h1-2H;2*1,3-4H2,2H3; |
| InChIKey | VUBDAXYSEGMYFR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.00 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin;furan-2,5-dione?
The IUPAC name of dibutyltin;furan-2,5-dione (CID 161399584) is dibutyltin;furan-2,5-dione.
What is the SMILES notation for dibutyltin;furan-2,5-dione?
The canonical SMILES for dibutyltin;furan-2,5-dione is CCCC[Sn]CCCC.O=C1C=CC(=O)O1.
What is the InChIKey of dibutyltin;furan-2,5-dione?
The InChIKey is VUBDAXYSEGMYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.2C4H9.Sn/c5-3-1-2-4(6)7-3;2*1-3-4-2;/h1-2H;2*1,3-4H2,2H3;.
What are the key properties of dibutyltin;furan-2,5-dione?
dibutyltin;furan-2,5-dione has a molecular weight of 331.00 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin;furan-2,5-dione is sourced from PubChem (CID 161399584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).