C29H30Cl3FN2O4S — CID 161401124
(2'R,3S,4'R,5'R)-6-chloro-4'-(3-chlorophenyl)-5'-[(5S)-5,6-dihydroxyhexanoyl]-5-fluoro-2'-(2-thiophen-3-ylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride (PubChem CID 161401124) has the molecular formula C29H30Cl3FN2O4S and a molecular weight of 627.99 g/mol. Its IUPAC name is (2'R,3S,4'R,5'R)-6-chloro-4'-(3-chlorophenyl)-5'-[(5S)-5,6-dihydroxyhexanoyl]-5-fluoro-2'-(2-thiophen-3-ylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride.
| Compound Name | (2'R,3S,4'R,5'R)-6-chloro-4'-(3-chlorophenyl)-5'-[(5S)-5,6-dihydroxyhexanoyl]-5-fluoro-2'-(2-thiophen-3-ylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride |
|---|---|
| PubChem CID | 161401124 |
| Molecular Formula | C29H30Cl3FN2O4S |
| Molecular Weight | 627.99 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | (2'R,3S,4'R,5'R)-6-chloro-4'-(3-chlorophenyl)-5'-[(5S)-5,6-dihydroxyhexanoyl]-5-fluoro-2'-(2-thiophen-3-ylethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride |
| SMILES | Cl.O=C(CCC[C@H](O)CO)[C@@H]1N[C@H](CCc2ccsc2)[C@]2(C(=O)Nc3cc(Cl)c(F)cc32)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H29Cl2FN2O4S.ClH/c30-18-4-1-3-17(11-18)26-27(24(37)6-2-5-19(36)14-35)34-25(8-7-16-9-10-39-15-16)29(26)20-12-22(32)21(31)13-23(20)33-28(29)38;/h1,3-4,9-13,15,19,25-27,34-36H,2,5-8,14H2,(H,33,38);1H/t19-,25+,26-,27-,29-;/m0./s1 |
| InChIKey | DYRNBEUOXGVMLA-IAIHOSISSA-N |
| XLogP | 5.66 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.99 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |