C22H22Cl2FN3O4 — CID 118680353
(2'R,3S,3'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 118680353) has the molecular formula C22H22Cl2FN3O4 and a molecular weight of 482.34 g/mol. Its IUPAC name is (2'R,3S,3'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 118680353 |
| Molecular Formula | C22H22Cl2FN3O4 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (2'R,3S,3'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | O=C(NCC[C@H](O)CO)[C@@H]1NC[C@]2(C(=O)Nc3cc(Cl)c(F)cc32)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22Cl2FN3O4/c23-12-3-1-2-11(6-12)18-19(20(31)26-5-4-13(30)9-29)27-10-22(18)14-7-16(25)15(24)8-17(14)28-21(22)32/h1-3,6-8,13,18-19,27,29-30H,4-5,9-10H2,(H,26,31)(H,28,32)/t13-,18-,19+,22+/m0/s1 |
| InChIKey | IXRMUHASZHIUCQ-VSMYDVMFSA-N |
| XLogP | 1.94 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |