C29H35Cl2F2N3O4 — CID 25053949
(2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(5R)-5,6-dihydroxyhexyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 25053949) has the molecular formula C29H35Cl2F2N3O4 and a molecular weight of 598.52 g/mol. Its IUPAC name is (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(5R)-5,6-dihydroxyhexyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(5R)-5,6-dihydroxyhexyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 25053949 |
| Molecular Formula | C29H35Cl2F2N3O4 |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | (2'R,3S,3'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-N-[(5R)-5,6-dihydroxyhexyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)NCCCC[C@@H](O)CO)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C29H35Cl2F2N3O4/c1-28(2,3)13-22-29(17-11-20(32)19(31)12-21(17)35-27(29)40)23(16-8-6-9-18(30)24(16)33)25(36-22)26(39)34-10-5-4-7-15(38)14-37/h6,8-9,11-12,15,22-23,25,36-38H,4-5,7,10,13-14H2,1-3H3,(H,34,39)(H,35,40)/t15-,22-,23+,25-,29+/m1/s1 |
| InChIKey | LMLKQZPKCGCTTG-GWVAYAJGSA-N |
| XLogP | 4.66 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|