C30H37ClF3N3O4 — CID 118796701
(2'R,3S,3'S,5'R)-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5,6-difluoro-2-oxo-5'-(2,2,4-trimethylpentyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 118796701) has the molecular formula C30H37ClF3N3O4 and a molecular weight of 596.09 g/mol. Its IUPAC name is (2'R,3S,3'S,5'R)-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5,6-difluoro-2-oxo-5'-(2,2,4-trimethylpentyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'S,5'R)-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5,6-difluoro-2-oxo-5'-(2,2,4-trimethylpentyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 118796701 |
| Molecular Formula | C30H37ClF3N3O4 |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (2'R,3S,3'S,5'R)-3'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5,6-difluoro-2-oxo-5'-(2,2,4-trimethylpentyl)spiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)CC(C)(C)C[C@H]1N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(F)c(F)cc12 |
| InChI | InChI=1S/C30H37ClF3N3O4/c1-15(2)12-29(3,4)13-23-30(18-10-20(32)21(33)11-22(18)36-28(30)41)24(17-6-5-7-19(31)25(17)34)26(37-23)27(40)35-9-8-16(39)14-38/h5-7,10-11,15-16,23-24,26,37-39H,8-9,12-14H2,1-4H3,(H,35,40)(H,36,41)/t16-,23+,24-,26+,30-/m0/s1 |
| InChIKey | BDWPNDHQTXTDID-QISNEAOYSA-N |
| XLogP | 4.39 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |