C26H30Cl2FN3O3 — CID 144664031
(2'R,3R,3'R,5'S)-5'-tert-butyl-6-chloro-3'-(3-chlorophenyl)-5-fluoro-N-(4-hydroxybutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 144664031) has the molecular formula C26H30Cl2FN3O3 and a molecular weight of 522.45 g/mol. Its IUPAC name is (2'R,3R,3'R,5'S)-5'-tert-butyl-6-chloro-3'-(3-chlorophenyl)-5-fluoro-N-(4-hydroxybutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3R,3'R,5'S)-5'-tert-butyl-6-chloro-3'-(3-chlorophenyl)-5-fluoro-N-(4-hydroxybutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 144664031 |
| Molecular Formula | C26H30Cl2FN3O3 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (2'R,3R,3'R,5'S)-5'-tert-butyl-6-chloro-3'-(3-chlorophenyl)-5-fluoro-N-(4-hydroxybutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)[C@@H]1N[C@@H](C(=O)NCCCCO)[C@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C26H30Cl2FN3O3/c1-25(2,3)23-26(16-12-18(29)17(28)13-19(16)31-24(26)35)20(14-7-6-8-15(27)11-14)21(32-23)22(34)30-9-4-5-10-33/h6-8,11-13,20-21,23,32-33H,4-5,9-10H2,1-3H3,(H,30,34)(H,31,35)/t20-,21+,23-,26-/m0/s1 |
| InChIKey | KIKUJYRFXHPBMQ-HPJLMOCUSA-N |
| XLogP | 4.38 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|