C17H23N3O5 — CID 161403917
4-[[5-(3-methoxypropoxy)-1,3-benzoxazol-2-yl]amino]piperidine-1-carboxylic acid (PubChem CID 161403917) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[[5-(3-methoxypropoxy)-1,3-benzoxazol-2-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[5-(3-methoxypropoxy)-1,3-benzoxazol-2-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 161403917 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-[[5-(3-methoxypropoxy)-1,3-benzoxazol-2-yl]amino]piperidine-1-carboxylic acid |
| SMILES | COCCCOc1ccc2oc(NC3CCN(C(=O)O)CC3)nc2c1 |
| InChI | InChI=1S/C17H23N3O5/c1-23-9-2-10-24-13-3-4-15-14(11-13)19-16(25-15)18-12-5-7-20(8-6-12)17(21)22/h3-4,11-12H,2,5-10H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | VUOYXKJVTHEICM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|